C26H27ClN2O5 — CID 46084044
5-[(2-chlorophenyl)methoxy]-2-[[4-(2-ethoxybenzoyl)piperazin-1-yl]methyl]pyran-4-one (PubChem CID 46084044) has the molecular formula C26H27ClN2O5 and a molecular weight of 482.96 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methoxy]-2-[[4-(2-ethoxybenzoyl)piperazin-1-yl]methyl]pyran-4-one.
| Compound Name | 5-[(2-chlorophenyl)methoxy]-2-[[4-(2-ethoxybenzoyl)piperazin-1-yl]methyl]pyran-4-one |
|---|---|
| PubChem CID | 46084044 |
| Molecular Formula | C26H27ClN2O5 |
| Molecular Weight | 482.96 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 5-[(2-chlorophenyl)methoxy]-2-[[4-(2-ethoxybenzoyl)piperazin-1-yl]methyl]pyran-4-one |
| SMILES | CCOc1ccccc1C(=O)N1CCN(Cc2cc(=O)c(OCc3ccccc3Cl)co2)CC1 |
| InChI | InChI=1S/C26H27ClN2O5/c1-2-32-24-10-6-4-8-21(24)26(31)29-13-11-28(12-14-29)16-20-15-23(30)25(18-33-20)34-17-19-7-3-5-9-22(19)27/h3-10,15,18H,2,11-14,16-17H2,1H3 |
| InChIKey | ADPPANGYZBVZEG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.96 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |