C24H30N4O4 — CID 46084352
ethyl 5-[4-[5-[(4-methylbenzoyl)amino]-2-pyridinyl]piperazin-1-yl]-5-oxopentanoate (PubChem CID 46084352) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is ethyl 5-[4-[5-[(4-methylbenzoyl)amino]-2-pyridinyl]piperazin-1-yl]-5-oxopentanoate.
| Compound Name | ethyl 5-[4-[5-[(4-methylbenzoyl)amino]-2-pyridinyl]piperazin-1-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 46084352 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | ethyl 5-[4-[5-[(4-methylbenzoyl)amino]-2-pyridinyl]piperazin-1-yl]-5-oxopentanoate |
| SMILES | CCOC(=O)CCCC(=O)N1CCN(c2ccc(NC(=O)c3ccc(C)cc3)cn2)CC1 |
| InChI | InChI=1S/C24H30N4O4/c1-3-32-23(30)6-4-5-22(29)28-15-13-27(14-16-28)21-12-11-20(17-25-21)26-24(31)19-9-7-18(2)8-10-19/h7-12,17H,3-6,13-16H2,1-2H3,(H,26,31) |
| InChIKey | SDINABQDLPZVIQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |