About N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide
N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide (PubChem CID 46084509) has the molecular formula C24H25FN4O3S
and a molecular weight of 468.55 g/mol. Its IUPAC name is N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide.
Molecular Properties
| Compound Name | N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide |
| PubChem CID | 46084509 |
| Molecular Formula | C24H25FN4O3S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)N2CCN(c3ccc(NC(=O)c4ccc(F)cc4)cn3)CC2)c1 |
| InChI | InChI=1S/C24H25FN4O3S/c1-17-13-18(2)15-22(14-17)33(31,32)29-11-9-28(10-12-29)23-8-7-21(16-26-23)27-24(30)19-3-5-20(25)6-4-19/h3-8,13-16H,9-12H2,1-2H3,(H,27,30) |
| InChIKey | ZWUXYZIRNHZXON-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide?
The IUPAC name of N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide (CID 46084509) is N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide.
What is the SMILES notation for N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide?
The canonical SMILES for N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide is Cc1cc(C)cc(S(=O)(=O)N2CCN(c3ccc(NC(=O)c4ccc(F)cc4)cn3)CC2)c1.
What is the InChIKey of N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide?
The InChIKey is ZWUXYZIRNHZXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25FN4O3S/c1-17-13-18(2)15-22(14-17)33(31,32)29-11-9-28(10-12-29)23-8-7-21(16-26-23)27-24(30)19-3-5-20(25)6-4-19/h3-8,13-16H,9-12H2,1-2H3,(H,27,30).
What are the key properties of N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide?
N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide has a molecular weight of 468.55 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-3-pyridinyl]-4-fluorobenzamide is sourced from PubChem (CID 46084509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).