C27H21F4N3O2 — CID 46085003
[4-(4-cyanophenyl)-1-[(2,3,4,5-tetrafluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate (PubChem CID 46085003) has the molecular formula C27H21F4N3O2 and a molecular weight of 495.48 g/mol. Its IUPAC name is [4-(4-cyanophenyl)-1-[(2,3,4,5-tetrafluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate.
| Compound Name | [4-(4-cyanophenyl)-1-[(2,3,4,5-tetrafluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 46085003 |
| Molecular Formula | C27H21F4N3O2 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | [4-(4-cyanophenyl)-1-[(2,3,4,5-tetrafluorophenyl)methyl]indol-5-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2cc(F)c(F)c(F)c2F)c1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H21F4N3O2/c1-3-33(4-2)27(35)36-22-10-9-21-19(23(22)17-7-5-16(14-32)6-8-17)11-12-34(21)15-18-13-20(28)25(30)26(31)24(18)29/h5-13H,3-4,15H2,1-2H3 |
| InChIKey | JKGZHQFKWAOOKF-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 58.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|