About [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate
[4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate (PubChem CID 46085009) has the molecular formula C29H31FN2O2
and a molecular weight of 458.58 g/mol. Its IUPAC name is [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate.
Molecular Properties
| Compound Name | [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate |
| PubChem CID | 46085009 |
| Molecular Formula | C29H31FN2O2 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2cc(F)ccc2C)c1-c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C29H31FN2O2/c1-6-31(7-2)29(33)34-27-11-10-26-25(28(27)22-15-19(3)14-20(4)16-22)12-13-32(26)18-23-17-24(30)9-8-21(23)5/h8-17H,6-7,18H2,1-5H3 |
| InChIKey | KXKXGZJXZQMMGX-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate?
The IUPAC name of [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate (CID 46085009) is [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate.
What is the SMILES notation for [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate?
The canonical SMILES for [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate is CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2cc(F)ccc2C)c1-c1cc(C)cc(C)c1.
What is the InChIKey of [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate?
The InChIKey is KXKXGZJXZQMMGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H31FN2O2/c1-6-31(7-2)29(33)34-27-11-10-26-25(28(27)22-15-19(3)14-20(4)16-22)12-13-32(26)18-23-17-24(30)9-8-21(23)5/h8-17H,6-7,18H2,1-5H3.
What are the key properties of [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate?
[4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate has a molecular weight of 458.58 g/mol, XLogP of 7.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,5-dimethylphenyl)-1-[(5-fluoro-2-methylphenyl)methyl]indol-5-yl] N,N-diethylcarbamate is sourced from PubChem (CID 46085009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).