About [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate
[1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate (PubChem CID 46086100) has the molecular formula C27H25ClFN3O3
and a molecular weight of 493.97 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate.
Molecular Properties
| Compound Name | [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate |
| PubChem CID | 46086100 |
| Molecular Formula | C27H25ClFN3O3 |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2ccccc2Cl)c1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C27H25ClFN3O3/c1-3-31(4-2)27(34)35-24-13-12-23-21(14-15-32(23)17-19-8-5-6-11-22(19)28)25(24)30-26(33)18-9-7-10-20(29)16-18/h5-16H,3-4,17H2,1-2H3,(H,30,33) |
| InChIKey | XZBFNYYWNLHKMR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate?
The IUPAC name of [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate (CID 46086100) is [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate.
What is the SMILES notation for [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate?
The canonical SMILES for [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate is CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2ccccc2Cl)c1NC(=O)c1cccc(F)c1.
What is the InChIKey of [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate?
The InChIKey is XZBFNYYWNLHKMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25ClFN3O3/c1-3-31(4-2)27(34)35-24-13-12-23-21(14-15-32(23)17-19-8-5-6-11-22(19)28)25(24)30-26(33)18-9-7-10-20(29)16-18/h5-16H,3-4,17H2,1-2H3,(H,30,33).
What are the key properties of [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate?
[1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate has a molecular weight of 493.97 g/mol, XLogP of 6.57, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-chlorophenyl)methyl]-4-[(3-fluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate is sourced from PubChem (CID 46086100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).