C27H23F4N3O3 — CID 46086113
[1-[(4-fluorophenyl)methyl]-4-[(2,3,4-trifluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate (PubChem CID 46086113) has the molecular formula C27H23F4N3O3 and a molecular weight of 513.49 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methyl]-4-[(2,3,4-trifluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate.
| Compound Name | [1-[(4-fluorophenyl)methyl]-4-[(2,3,4-trifluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 46086113 |
| Molecular Formula | C27H23F4N3O3 |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | [1-[(4-fluorophenyl)methyl]-4-[(2,3,4-trifluorobenzoyl)amino]indol-5-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2ccc(F)cc2)c1NC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C27H23F4N3O3/c1-3-33(4-2)27(36)37-22-12-11-21-18(13-14-34(21)15-16-5-7-17(28)8-6-16)25(22)32-26(35)19-9-10-20(29)24(31)23(19)30/h5-14H,3-4,15H2,1-2H3,(H,32,35) |
| InChIKey | MVTUBUXCVKAFEY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|