C27H35N3O7 — CID 46086179
[1-(2-ethoxyethyl)-4-[(3,4,5-trimethoxybenzoyl)amino]indol-5-yl] N,N-diethylcarbamate (PubChem CID 46086179) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is [1-(2-ethoxyethyl)-4-[(3,4,5-trimethoxybenzoyl)amino]indol-5-yl] N,N-diethylcarbamate.
| Compound Name | [1-(2-ethoxyethyl)-4-[(3,4,5-trimethoxybenzoyl)amino]indol-5-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 46086179 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | [1-(2-ethoxyethyl)-4-[(3,4,5-trimethoxybenzoyl)amino]indol-5-yl] N,N-diethylcarbamate |
| SMILES | CCOCCn1ccc2c(NC(=O)c3cc(OC)c(OC)c(OC)c3)c(OC(=O)N(CC)CC)ccc21 |
| InChI | InChI=1S/C27H35N3O7/c1-7-29(8-2)27(32)37-21-11-10-20-19(12-13-30(20)14-15-36-9-3)24(21)28-26(31)18-16-22(33-4)25(35-6)23(17-18)34-5/h10-13,16-17H,7-9,14-15H2,1-6H3,(H,28,31) |
| InChIKey | BCVSHUTYVCPMPC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|