C23H24F3NO3 — CID 46086782
[2-oxo-1-phenyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]ethyl] acetate (PubChem CID 46086782) has the molecular formula C23H24F3NO3 and a molecular weight of 419.44 g/mol. Its IUPAC name is [2-oxo-1-phenyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]ethyl] acetate.
| Compound Name | [2-oxo-1-phenyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]ethyl] acetate |
|---|---|
| PubChem CID | 46086782 |
| Molecular Formula | C23H24F3NO3 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [2-oxo-1-phenyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]ethyl] acetate |
| SMILES | CC(=O)OC(C(=O)N1CCC(Cc2ccc(C(F)(F)F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H24F3NO3/c1-16(28)30-21(19-5-3-2-4-6-19)22(29)27-13-11-18(12-14-27)15-17-7-9-20(10-8-17)23(24,25)26/h2-10,18,21H,11-15H2,1H3 |
| InChIKey | MKRCMHWISYKSFU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |