C21H26N2O — CID 46086793
3-methyl-1-[4-[(4-pyrrol-1-ylphenyl)methyl]piperidin-1-yl]but-2-en-1-one (PubChem CID 46086793) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 3-methyl-1-[4-[(4-pyrrol-1-ylphenyl)methyl]piperidin-1-yl]but-2-en-1-one.
| Compound Name | 3-methyl-1-[4-[(4-pyrrol-1-ylphenyl)methyl]piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 46086793 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 3-methyl-1-[4-[(4-pyrrol-1-ylphenyl)methyl]piperidin-1-yl]but-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1CCC(Cc2ccc(-n3cccc3)cc2)CC1 |
| InChI | InChI=1S/C21H26N2O/c1-17(2)15-21(24)23-13-9-19(10-14-23)16-18-5-7-20(8-6-18)22-11-3-4-12-22/h3-8,11-12,15,19H,9-10,13-14,16H2,1-2H3 |
| InChIKey | WKPZIJJYGALKQH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|