About (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone
(5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone (PubChem CID 46087245) has the molecular formula C19H18N2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone |
| PubChem CID | 46087245 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1cc(-c2ccc3ccccc3c2)on1)N1CCCCC1 |
| InChI | InChI=1S/C19H18N2O2/c22-19(21-10-4-1-5-11-21)17-13-18(23-20-17)16-9-8-14-6-2-3-7-15(14)12-16/h2-3,6-9,12-13H,1,4-5,10-11H2 |
| InChIKey | VFGDIMQGDZJQIR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone?
The IUPAC name of (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone (CID 46087245) is (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone.
What is the SMILES notation for (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone?
The canonical SMILES for (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone is O=C(c1cc(-c2ccc3ccccc3c2)on1)N1CCCCC1.
What is the InChIKey of (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone?
The InChIKey is VFGDIMQGDZJQIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2/c22-19(21-10-4-1-5-11-21)17-13-18(23-20-17)16-9-8-14-6-2-3-7-15(14)12-16/h2-3,6-9,12-13H,1,4-5,10-11H2.
What are the key properties of (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone?
(5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone has a molecular weight of 306.37 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-naphthalen-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone is sourced from PubChem (CID 46087245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).