C19H24N2O2S — CID 46087580
(2E)-N-(3,3-dimethylbutan-2-yl)-2-(3-oxo-4-prop-2-enyl-1,4-benzothiazin-2-ylidene)acetamide (PubChem CID 46087580) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is (2E)-N-(3,3-dimethylbutan-2-yl)-2-(3-oxo-4-prop-2-enyl-1,4-benzothiazin-2-ylidene)acetamide.
| Compound Name | (2E)-N-(3,3-dimethylbutan-2-yl)-2-(3-oxo-4-prop-2-enyl-1,4-benzothiazin-2-ylidene)acetamide |
|---|---|
| PubChem CID | 46087580 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2E)-N-(3,3-dimethylbutan-2-yl)-2-(3-oxo-4-prop-2-enyl-1,4-benzothiazin-2-ylidene)acetamide |
| SMILES | C=CCN1C(=O)/C(=C\C(=O)NC(C)C(C)(C)C)Sc2ccccc21 |
| InChI | InChI=1S/C19H24N2O2S/c1-6-11-21-14-9-7-8-10-15(14)24-16(18(21)23)12-17(22)20-13(2)19(3,4)5/h6-10,12-13H,1,11H2,2-5H3,(H,20,22)/b16-12+ |
| InChIKey | WJMRTUNITHOZAC-FOWTUZBSSA-N |
| XLogP | 3.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|