C32H36ClN3O4S — CID 46088346
(E)-1-[4-[5-(4-benzylpiperidin-1-yl)sulfonyl-2-methoxyphenyl]piperazin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one (PubChem CID 46088346) has the molecular formula C32H36ClN3O4S and a molecular weight of 594.18 g/mol. Its IUPAC name is (E)-1-[4-[5-(4-benzylpiperidin-1-yl)sulfonyl-2-methoxyphenyl]piperazin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[5-(4-benzylpiperidin-1-yl)sulfonyl-2-methoxyphenyl]piperazin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 46088346 |
| Molecular Formula | C32H36ClN3O4S |
| Molecular Weight | 594.18 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | (E)-1-[4-[5-(4-benzylpiperidin-1-yl)sulfonyl-2-methoxyphenyl]piperazin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)cc1N1CCN(C(=O)/C=C/c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C32H36ClN3O4S/c1-40-31-13-12-28(41(38,39)36-17-15-26(16-18-36)23-25-7-3-2-4-8-25)24-30(31)34-19-21-35(22-20-34)32(37)14-11-27-9-5-6-10-29(27)33/h2-14,24,26H,15-23H2,1H3/b14-11+ |
| InChIKey | CEADFUDOZFIUTH-SDNWHVSQSA-N |
| XLogP | 5.35 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.18 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|