C25H40N4O5S — CID 46088632
3-[4-(cyclohexanecarbonyl)piperazin-1-yl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide (PubChem CID 46088632) has the molecular formula C25H40N4O5S and a molecular weight of 508.69 g/mol. Its IUPAC name is 3-[4-(cyclohexanecarbonyl)piperazin-1-yl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide.
| Compound Name | 3-[4-(cyclohexanecarbonyl)piperazin-1-yl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46088632 |
| Molecular Formula | C25H40N4O5S |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 3-[4-(cyclohexanecarbonyl)piperazin-1-yl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCN2CCOCC2)cc1N1CCN(C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C25H40N4O5S/c1-33-24-9-8-22(35(31,32)26-10-5-11-27-16-18-34-19-17-27)20-23(24)28-12-14-29(15-13-28)25(30)21-6-3-2-4-7-21/h8-9,20-21,26H,2-7,10-19H2,1H3 |
| InChIKey | AQXSZXIVULRXEL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|