About 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole
2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole (PubChem CID 46088966) has the molecular formula C22H18ClNO4
and a molecular weight of 395.84 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole |
| PubChem CID | 46088966 |
| Molecular Formula | C22H18ClNO4 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole |
| SMILES | COc1ccc(-c2ccc3nc(-c4cccc(Cl)c4)oc3c2)c(OC)c1OC |
| InChI | InChI=1S/C22H18ClNO4/c1-25-18-10-8-16(20(26-2)21(18)27-3)13-7-9-17-19(12-13)28-22(24-17)14-5-4-6-15(23)11-14/h4-12H,1-3H3 |
| InChIKey | AOEVLZXFIZKXLF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole?
The IUPAC name of 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole (CID 46088966) is 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole.
What is the SMILES notation for 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole?
The canonical SMILES for 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole is COc1ccc(-c2ccc3nc(-c4cccc(Cl)c4)oc3c2)c(OC)c1OC.
What is the InChIKey of 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole?
The InChIKey is AOEVLZXFIZKXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18ClNO4/c1-25-18-10-8-16(20(26-2)21(18)27-3)13-7-9-17-19(12-13)28-22(24-17)14-5-4-6-15(23)11-14/h4-12H,1-3H3.
What are the key properties of 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole?
2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole has a molecular weight of 395.84 g/mol, XLogP of 5.84, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-6-(2,3,4-trimethoxyphenyl)-1,3-benzoxazole is sourced from PubChem (CID 46088966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).