About 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole
2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole (PubChem CID 46089076) has the molecular formula C18H16BrNO3
and a molecular weight of 374.23 g/mol. Its IUPAC name is 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole |
| PubChem CID | 46089076 |
| Molecular Formula | C18H16BrNO3 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole |
| SMILES | CC(C)(C)c1ccc2oc(-c3cc4c(cc3Br)OCO4)nc2c1 |
| InChI | InChI=1S/C18H16BrNO3/c1-18(2,3)10-4-5-14-13(6-10)20-17(23-14)11-7-15-16(8-12(11)19)22-9-21-15/h4-8H,9H2,1-3H3 |
| InChIKey | KHYAGLIYFYXXRN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole?
The IUPAC name of 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole (CID 46089076) is 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole.
What is the SMILES notation for 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole?
The canonical SMILES for 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole is CC(C)(C)c1ccc2oc(-c3cc4c(cc3Br)OCO4)nc2c1.
What is the InChIKey of 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole?
The InChIKey is KHYAGLIYFYXXRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrNO3/c1-18(2,3)10-4-5-14-13(6-10)20-17(23-14)11-7-15-16(8-12(11)19)22-9-21-15/h4-8H,9H2,1-3H3.
What are the key properties of 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole?
2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole has a molecular weight of 374.23 g/mol, XLogP of 5.28, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-1,3-benzodioxol-5-yl)-5-tert-butyl-1,3-benzoxazole is sourced from PubChem (CID 46089076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).