About 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole
6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole (PubChem CID 46089152) has the molecular formula C20H12BrNO3
and a molecular weight of 394.22 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole |
| PubChem CID | 46089152 |
| Molecular Formula | C20H12BrNO3 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole |
| SMILES | Brc1ccccc1-c1nc2ccc(-c3ccc4c(c3)OCO4)cc2o1 |
| InChI | InChI=1S/C20H12BrNO3/c21-15-4-2-1-3-14(15)20-22-16-7-5-12(9-18(16)25-20)13-6-8-17-19(10-13)24-11-23-17/h1-10H,11H2 |
| InChIKey | VQBLFJVDOLPSBS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole?
The IUPAC name of 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole (CID 46089152) is 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole.
What is the SMILES notation for 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole?
The canonical SMILES for 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole is Brc1ccccc1-c1nc2ccc(-c3ccc4c(c3)OCO4)cc2o1.
What is the InChIKey of 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole?
The InChIKey is VQBLFJVDOLPSBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12BrNO3/c21-15-4-2-1-3-14(15)20-22-16-7-5-12(9-18(16)25-20)13-6-8-17-19(10-13)24-11-23-17/h1-10H,11H2.
What are the key properties of 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole?
6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole has a molecular weight of 394.22 g/mol, XLogP of 5.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzodioxol-5-yl)-2-(2-bromophenyl)-1,3-benzoxazole is sourced from PubChem (CID 46089152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).