C26H24FN3O — CID 46089570
N-[[3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl]methyl]-2-phenylbutanamide (PubChem CID 46089570) has the molecular formula C26H24FN3O and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[[3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl]methyl]-2-phenylbutanamide.
| Compound Name | N-[[3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl]methyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 46089570 |
| Molecular Formula | C26H24FN3O |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[[3-[5-(4-fluorophenyl)-1H-imidazol-2-yl]phenyl]methyl]-2-phenylbutanamide |
| SMILES | CCC(C(=O)NCc1cccc(-c2ncc(-c3ccc(F)cc3)[nH]2)c1)c1ccccc1 |
| InChI | InChI=1S/C26H24FN3O/c1-2-23(19-8-4-3-5-9-19)26(31)29-16-18-7-6-10-21(15-18)25-28-17-24(30-25)20-11-13-22(27)14-12-20/h3-15,17,23H,2,16H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | WSZHJHYSKOGNRT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |