C35H39F3N2O2 — CID 46089898
(4-heptoxyphenyl)-[4-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]piperidin-1-yl]methanone (PubChem CID 46089898) has the molecular formula C35H39F3N2O2 and a molecular weight of 576.70 g/mol. Its IUPAC name is (4-heptoxyphenyl)-[4-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]piperidin-1-yl]methanone.
| Compound Name | (4-heptoxyphenyl)-[4-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46089898 |
| Molecular Formula | C35H39F3N2O2 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | (4-heptoxyphenyl)-[4-[1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]piperidin-1-yl]methanone |
| SMILES | CCCCCCCOc1ccc(C(=O)N2CCC(c3cn(Cc4ccc(C(F)(F)F)cc4)c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C35H39F3N2O2/c1-2-3-4-5-8-23-42-30-17-13-28(14-18-30)34(41)39-21-19-27(20-22-39)32-25-40(33-10-7-6-9-31(32)33)24-26-11-15-29(16-12-26)35(36,37)38/h6-7,9-18,25,27H,2-5,8,19-24H2,1H3 |
| InChIKey | RWSUZUVQOGCPOM-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|