C26H27Cl2N3O3 — CID 46091185
[4-[2-(4-chlorophenyl)-2-[(3-methoxyphenyl)methoxy]ethyl]piperazin-1-yl]-(2-chloro-3-pyridinyl)methanone (PubChem CID 46091185) has the molecular formula C26H27Cl2N3O3 and a molecular weight of 500.43 g/mol. Its IUPAC name is [4-[2-(4-chlorophenyl)-2-[(3-methoxyphenyl)methoxy]ethyl]piperazin-1-yl]-(2-chloro-3-pyridinyl)methanone.
| Compound Name | [4-[2-(4-chlorophenyl)-2-[(3-methoxyphenyl)methoxy]ethyl]piperazin-1-yl]-(2-chloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 46091185 |
| Molecular Formula | C26H27Cl2N3O3 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | [4-[2-(4-chlorophenyl)-2-[(3-methoxyphenyl)methoxy]ethyl]piperazin-1-yl]-(2-chloro-3-pyridinyl)methanone |
| SMILES | COc1cccc(COC(CN2CCN(C(=O)c3cccnc3Cl)CC2)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C26H27Cl2N3O3/c1-33-22-5-2-4-19(16-22)18-34-24(20-7-9-21(27)10-8-20)17-30-12-14-31(15-13-30)26(32)23-6-3-11-29-25(23)28/h2-11,16,24H,12-15,17-18H2,1H3 |
| InChIKey | IOGLYNQIEFQZJY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|