C25H20F3N3O2 — CID 46091627
N-[(4-methoxyphenyl)methyl]-4-[3-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]benzamide (PubChem CID 46091627) has the molecular formula C25H20F3N3O2 and a molecular weight of 451.45 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-4-[3-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]benzamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-4-[3-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 46091627 |
| Molecular Formula | C25H20F3N3O2 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-4-[3-[3-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(-c3cc(-c4cccc(C(F)(F)F)c4)n[nH]3)cc2)cc1 |
| InChI | InChI=1S/C25H20F3N3O2/c1-33-21-11-5-16(6-12-21)15-29-24(32)18-9-7-17(8-10-18)22-14-23(31-30-22)19-3-2-4-20(13-19)25(26,27)28/h2-14H,15H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | GWIKGXNZPOWYFC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |