C27H25N3O — CID 46091982
4-(3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)-N-[(2-methylphenyl)methyl]benzamide (PubChem CID 46091982) has the molecular formula C27H25N3O and a molecular weight of 407.52 g/mol. Its IUPAC name is 4-(3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)-N-[(2-methylphenyl)methyl]benzamide.
| Compound Name | 4-(3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)-N-[(2-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 46091982 |
| Molecular Formula | C27H25N3O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-(3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-5-yl)-N-[(2-methylphenyl)methyl]benzamide |
| SMILES | Cc1ccccc1CNC(=O)c1ccc(-c2n[nH]c3c2CCCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C27H25N3O/c1-18-7-2-3-9-22(18)17-28-27(31)21-15-13-20(14-16-21)25-24-12-6-10-19-8-4-5-11-23(19)26(24)30-29-25/h2-5,7-9,11,13-16H,6,10,12,17H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | PRISQBLFECNWBL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |