C28H27N3O3 — CID 46092192
4-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazol-5-yl]-N-(4-phenylbutyl)benzamide (PubChem CID 46092192) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazol-5-yl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 4-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazol-5-yl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 46092192 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 4-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrazol-5-yl]-N-(4-phenylbutyl)benzamide |
| SMILES | O=C(NCCCCc1ccccc1)c1ccc(-c2cc(-c3ccc4c(c3)OCCO4)n[nH]2)cc1 |
| InChI | InChI=1S/C28H27N3O3/c32-28(29-15-5-4-8-20-6-2-1-3-7-20)22-11-9-21(10-12-22)24-19-25(31-30-24)23-13-14-26-27(18-23)34-17-16-33-26/h1-3,6-7,9-14,18-19H,4-5,8,15-17H2,(H,29,32)(H,30,31) |
| InChIKey | WCNVZQKDCUFMOS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|