C27H28Cl2N6O — CID 46092847
[4-[7-(3,4-dichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-(4-pentylphenyl)methanone (PubChem CID 46092847) has the molecular formula C27H28Cl2N6O and a molecular weight of 523.47 g/mol. Its IUPAC name is [4-[7-(3,4-dichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-(4-pentylphenyl)methanone.
| Compound Name | [4-[7-(3,4-dichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-(4-pentylphenyl)methanone |
|---|---|
| PubChem CID | 46092847 |
| Molecular Formula | C27H28Cl2N6O |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | [4-[7-(3,4-dichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperazin-1-yl]-(4-pentylphenyl)methanone |
| SMILES | CCCCCc1ccc(C(=O)N2CCN(c3nc4nccc(-c5ccc(Cl)c(Cl)c5)n4n3)CC2)cc1 |
| InChI | InChI=1S/C27H28Cl2N6O/c1-2-3-4-5-19-6-8-20(9-7-19)25(36)33-14-16-34(17-15-33)27-31-26-30-13-12-24(35(26)32-27)21-10-11-22(28)23(29)18-21/h6-13,18H,2-5,14-17H2,1H3 |
| InChIKey | VZNXRFMMSDMVNO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|