C25H21Cl3N4O2S — CID 46093699
2-phenyl-3-[4-(2,4,5-trichlorophenyl)sulfonyl-1,4-diazepan-1-yl]quinoxaline (PubChem CID 46093699) has the molecular formula C25H21Cl3N4O2S and a molecular weight of 547.90 g/mol. Its IUPAC name is 2-phenyl-3-[4-(2,4,5-trichlorophenyl)sulfonyl-1,4-diazepan-1-yl]quinoxaline.
| Compound Name | 2-phenyl-3-[4-(2,4,5-trichlorophenyl)sulfonyl-1,4-diazepan-1-yl]quinoxaline |
|---|---|
| PubChem CID | 46093699 |
| Molecular Formula | C25H21Cl3N4O2S |
| Molecular Weight | 547.90 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | 2-phenyl-3-[4-(2,4,5-trichlorophenyl)sulfonyl-1,4-diazepan-1-yl]quinoxaline |
| SMILES | O=S(=O)(c1cc(Cl)c(Cl)cc1Cl)N1CCCN(c2nc3ccccc3nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C25H21Cl3N4O2S/c26-18-15-20(28)23(16-19(18)27)35(33,34)32-12-6-11-31(13-14-32)25-24(17-7-2-1-3-8-17)29-21-9-4-5-10-22(21)30-25/h1-5,7-10,15-16H,6,11-14H2 |
| InChIKey | DJCOJBOSJZGMMW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.90 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|