About ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate
ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate (PubChem CID 46094128) has the molecular formula C24H17F3N4O3
and a molecular weight of 466.42 g/mol. Its IUPAC name is ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate |
| PubChem CID | 46094128 |
| Molecular Formula | C24H17F3N4O3 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(NC(=O)c3cc(F)cc(F)c3F)c2)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C24H17F3N4O3/c1-2-34-24(33)19-13-20(31(30-19)21-8-3-4-9-28-21)14-6-5-7-16(10-14)29-23(32)17-11-15(25)12-18(26)22(17)27/h3-13H,2H2,1H3,(H,29,32) |
| InChIKey | GNDHMBQVZNUUTQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate?
The IUPAC name of ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate (CID 46094128) is ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate?
The canonical SMILES for ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate is CCOC(=O)c1cc(-c2cccc(NC(=O)c3cc(F)cc(F)c3F)c2)n(-c2ccccn2)n1.
What is the InChIKey of ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate?
The InChIKey is GNDHMBQVZNUUTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17F3N4O3/c1-2-34-24(33)19-13-20(31(30-19)21-8-3-4-9-28-21)14-6-5-7-16(10-14)29-23(32)17-11-15(25)12-18(26)22(17)27/h3-13H,2H2,1H3,(H,29,32).
What are the key properties of ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate?
ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate has a molecular weight of 466.42 g/mol, XLogP of 4.78, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-pyridin-2-yl-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate is sourced from PubChem (CID 46094128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).