C16H26N6 — CID 46094563
N,N,N'-triethyl-N'-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)ethane-1,2-diamine (PubChem CID 46094563) has the molecular formula C16H26N6 and a molecular weight of 302.43 g/mol. Its IUPAC name is N,N,N'-triethyl-N'-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)ethane-1,2-diamine.
| Compound Name | N,N,N'-triethyl-N'-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 46094563 |
| Molecular Formula | C16H26N6 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | N,N,N'-triethyl-N'-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCN(CC)c1c2c(nc3ncnn13)CCC2 |
| InChI | InChI=1S/C16H26N6/c1-4-20(5-2)10-11-21(6-3)15-13-8-7-9-14(13)19-16-17-12-18-22(15)16/h12H,4-11H2,1-3H3 |
| InChIKey | LDCDJQUQXTZKSQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |