C20H27N5O3 — CID 46094617
N,N-bis(2-ethoxyethyl)-5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 46094617) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)-5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N,N-bis(2-ethoxyethyl)-5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 46094617 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)-5-(4-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCOCCN(CCOCC)c1cc(-c2ccc(OC)cc2)nc2ncnn12 |
| InChI | InChI=1S/C20H27N5O3/c1-4-27-12-10-24(11-13-28-5-2)19-14-18(23-20-21-15-22-25(19)20)16-6-8-17(26-3)9-7-16/h6-9,14-15H,4-5,10-13H2,1-3H3 |
| InChIKey | ZHKTWPFJDKOZKD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|