C24H18F5NO3S — CID 46095066
ethyl 2-[(2,3,4,5,6-pentafluorobenzoyl)amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 46095066) has the molecular formula C24H18F5NO3S and a molecular weight of 495.47 g/mol. Its IUPAC name is ethyl 2-[(2,3,4,5,6-pentafluorobenzoyl)amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2,3,4,5,6-pentafluorobenzoyl)amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 46095066 |
| Molecular Formula | C24H18F5NO3S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | ethyl 2-[(2,3,4,5,6-pentafluorobenzoyl)amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2c(F)c(F)c(F)c(F)c2F)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C24H18F5NO3S/c1-2-33-24(32)15-13-9-8-12(11-6-4-3-5-7-11)10-14(13)34-23(15)30-22(31)16-17(25)19(27)21(29)20(28)18(16)26/h3-7,12H,2,8-10H2,1H3,(H,30,31) |
| InChIKey | AENUROKAXCAPJM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|