C18H24N2O5 — CID 46097321
5-(3,5-dimethoxyphenyl)-N-(3-ethoxypropyl)-3-methyl-1,2-oxazole-4-carboxamide (PubChem CID 46097321) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenyl)-N-(3-ethoxypropyl)-3-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 5-(3,5-dimethoxyphenyl)-N-(3-ethoxypropyl)-3-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46097321 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 5-(3,5-dimethoxyphenyl)-N-(3-ethoxypropyl)-3-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCOCCCNC(=O)c1c(C)noc1-c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C18H24N2O5/c1-5-24-8-6-7-19-18(21)16-12(2)20-25-17(16)13-9-14(22-3)11-15(10-13)23-4/h9-11H,5-8H2,1-4H3,(H,19,21) |
| InChIKey | YCCHLMIYIGVDAB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|