C17H26N6 — CID 46097512
N,N-diethyl-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidin-4-amine (PubChem CID 46097512) has the molecular formula C17H26N6 and a molecular weight of 314.44 g/mol. Its IUPAC name is N,N-diethyl-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidin-4-amine.
| Compound Name | N,N-diethyl-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 46097512 |
| Molecular Formula | C17H26N6 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | N,N-diethyl-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidin-4-amine |
| SMILES | CCN(CC)C1CCN(c2c3c(nc4ncnn24)CCC3)CC1 |
| InChI | InChI=1S/C17H26N6/c1-3-21(4-2)13-8-10-22(11-9-13)16-14-6-5-7-15(14)20-17-18-12-19-23(16)17/h12-13H,3-11H2,1-2H3 |
| InChIKey | KWJKYFPHWQNWPD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |