C24H15BrN4O6 — CID 4609786
2-[[1-(4-bromo-3-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-5-hydroxybenzo[de]isoquinoline-1,3-dione (PubChem CID 4609786) has the molecular formula C24H15BrN4O6 and a molecular weight of 535.31 g/mol. Its IUPAC name is 2-[[1-(4-bromo-3-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-5-hydroxybenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[[1-(4-bromo-3-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-5-hydroxybenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 4609786 |
| Molecular Formula | C24H15BrN4O6 |
| Molecular Weight | 535.31 g/mol |
| Exact Mass | 534.02 |
| IUPAC Name | 2-[[1-(4-bromo-3-methylphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-5-hydroxybenzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1cc(-n2c(O)c(C=NN3C(=O)c4cccc5cc(O)cc(c45)C3=O)c(=O)[nH]c2=O)ccc1Br |
| InChI | InChI=1S/C24H15BrN4O6/c1-11-7-13(5-6-18(11)25)28-21(32)17(20(31)27-24(28)35)10-26-29-22(33)15-4-2-3-12-8-14(30)9-16(19(12)15)23(29)34/h2-10,30,32H,1H3,(H,27,31,35) |
| InChIKey | MTLHZMPXQFPYFS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 145.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|