C19H20ClN3OS — CID 46098190
N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2,5-dimethyl-1,3-thiazol-4-yl)acetamide (PubChem CID 46098190) has the molecular formula C19H20ClN3OS and a molecular weight of 373.91 g/mol. Its IUPAC name is N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2,5-dimethyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2,5-dimethyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 46098190 |
| Molecular Formula | C19H20ClN3OS |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-(8-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-2-(2,5-dimethyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1nc(CC(=O)NC2CCc3[nH]c4c(Cl)cccc4c3C2)c(C)s1 |
| InChI | InChI=1S/C19H20ClN3OS/c1-10-17(21-11(2)25-10)9-18(24)22-12-6-7-16-14(8-12)13-4-3-5-15(20)19(13)23-16/h3-5,12,23H,6-9H2,1-2H3,(H,22,24) |
| InChIKey | SOQDFCKRKPJWDA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|