C27H32N6O2 — CID 46098567
6-(3,4-dimethoxyphenyl)-7-[4-[(2,4,6-trimethylphenyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 46098567) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-7-[4-[(2,4,6-trimethylphenyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 6-(3,4-dimethoxyphenyl)-7-[4-[(2,4,6-trimethylphenyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 46098567 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-7-[4-[(2,4,6-trimethylphenyl)methyl]piperazin-1-yl]-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | COc1ccc(-c2cnc3ncnn3c2N2CCN(Cc3c(C)cc(C)cc3C)CC2)cc1OC |
| InChI | InChI=1S/C27H32N6O2/c1-18-12-19(2)23(20(3)13-18)16-31-8-10-32(11-9-31)26-22(15-28-27-29-17-30-33(26)27)21-6-7-24(34-4)25(14-21)35-5/h6-7,12-15,17H,8-11,16H2,1-5H3 |
| InChIKey | FYQNPMGWETYTRM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |