C25H20ClFN2O2 — CID 46099134
N-[(3-chloro-4-fluorophenyl)methyl]-2-(4-ethoxyphenyl)quinoline-4-carboxamide (PubChem CID 46099134) has the molecular formula C25H20ClFN2O2 and a molecular weight of 434.90 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-2-(4-ethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-2-(4-ethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46099134 |
| Molecular Formula | C25H20ClFN2O2 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-2-(4-ethoxyphenyl)quinoline-4-carboxamide |
| SMILES | CCOc1ccc(-c2cc(C(=O)NCc3ccc(F)c(Cl)c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H20ClFN2O2/c1-2-31-18-10-8-17(9-11-18)24-14-20(19-5-3-4-6-23(19)29-24)25(30)28-15-16-7-12-22(27)21(26)13-16/h3-14H,2,15H2,1H3,(H,28,30) |
| InChIKey | BMCGGRCRLFMPME-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |