C29H35N3O — CID 46099484
3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N,N-dipropylpropanamide (PubChem CID 46099484) has the molecular formula C29H35N3O and a molecular weight of 441.62 g/mol. Its IUPAC name is 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N,N-dipropylpropanamide.
| Compound Name | 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 46099484 |
| Molecular Formula | C29H35N3O |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | 3-[1-[4-(cyanomethyl)phenyl]-5-(2,4-dimethylphenyl)pyrrol-2-yl]-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)CCc1ccc(-c2ccc(C)cc2C)n1-c1ccc(CC#N)cc1 |
| InChI | InChI=1S/C29H35N3O/c1-5-19-31(20-6-2)29(33)16-13-26-12-15-28(27-14-7-22(3)21-23(27)4)32(26)25-10-8-24(9-11-25)17-18-30/h7-12,14-15,21H,5-6,13,16-17,19-20H2,1-4H3 |
| InChIKey | PFVUPZXOZNILEE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|