About (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone
(2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone (PubChem CID 46100133) has the molecular formula C19H23NO3
and a molecular weight of 313.40 g/mol. Its IUPAC name is (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone.
Molecular Properties
| Compound Name | (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone |
| PubChem CID | 46100133 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone |
| SMILES | CC1=CCC=CC1C(=O)N1CCOC(COc2ccccc2)C1 |
| InChI | InChI=1S/C19H23NO3/c1-15-7-5-6-10-18(15)19(21)20-11-12-22-17(13-20)14-23-16-8-3-2-4-9-16/h2-4,6-10,17-18H,5,11-14H2,1H3 |
| InChIKey | MLSYDWKAIVRUHZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone?
The IUPAC name of (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone (CID 46100133) is (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone.
What is the SMILES notation for (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone?
The canonical SMILES for (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone is CC1=CCC=CC1C(=O)N1CCOC(COc2ccccc2)C1.
What is the InChIKey of (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone?
The InChIKey is MLSYDWKAIVRUHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO3/c1-15-7-5-6-10-18(15)19(21)20-11-12-22-17(13-20)14-23-16-8-3-2-4-9-16/h2-4,6-10,17-18H,5,11-14H2,1H3.
What are the key properties of (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone?
(2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone has a molecular weight of 313.40 g/mol, XLogP of 2.82, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone is sourced from PubChem (CID 46100133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).