C19H23NO3 — CID 46100133
(2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone (PubChem CID 46100133) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone.
| Compound Name | (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 46100133 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2-methylcyclohexa-2,5-dien-1-yl)-[2-(phenoxymethyl)morpholin-4-yl]methanone |
| SMILES | CC1=CCC=CC1C(=O)N1CCOC(COc2ccccc2)C1 |
| InChI | InChI=1S/C19H23NO3/c1-15-7-5-6-10-18(15)19(21)20-11-12-22-17(13-20)14-23-16-8-3-2-4-9-16/h2-4,6-10,17-18H,5,11-14H2,1H3 |
| InChIKey | MLSYDWKAIVRUHZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|