About N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide
N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide (PubChem CID 4610036) has the molecular formula C25H28N2O3
and a molecular weight of 404.51 g/mol. Its IUPAC name is N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide |
| PubChem CID | 4610036 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide |
| SMILES | CCOC(CNC(=O)C(c1ccccc1)c1ccccc1)(OCC)c1ccccn1 |
| InChI | InChI=1S/C25H28N2O3/c1-3-29-25(30-4-2,22-17-11-12-18-26-22)19-27-24(28)23(20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-18,23H,3-4,19H2,1-2H3,(H,27,28) |
| InChIKey | IRQSAPZUEHGCHV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide?
The IUPAC name of N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide (CID 4610036) is N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide.
What is the SMILES notation for N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide?
The canonical SMILES for N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide is CCOC(CNC(=O)C(c1ccccc1)c1ccccc1)(OCC)c1ccccn1.
What is the InChIKey of N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide?
The InChIKey is IRQSAPZUEHGCHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N2O3/c1-3-29-25(30-4-2,22-17-11-12-18-26-22)19-27-24(28)23(20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-18,23H,3-4,19H2,1-2H3,(H,27,28).
What are the key properties of N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide?
N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide has a molecular weight of 404.51 g/mol, XLogP of 4.26, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-diethoxy-2-pyridin-2-ylethyl)-2,2-diphenylacetamide is sourced from PubChem (CID 4610036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).