C25H16F4N2O3 — CID 46101105
2,3,4,5-tetrafluoro-N-[4-(7-methoxy-4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]benzamide (PubChem CID 46101105) has the molecular formula C25H16F4N2O3 and a molecular weight of 468.41 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[4-(7-methoxy-4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[4-(7-methoxy-4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 46101105 |
| Molecular Formula | C25H16F4N2O3 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[4-(7-methoxy-4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]benzamide |
| SMILES | COc1ccc2c(c1)CCc1c-2noc1-c1ccc(NC(=O)c2cc(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C25H16F4N2O3/c1-33-15-7-9-16-13(10-15)4-8-17-23(16)31-34-24(17)12-2-5-14(6-3-12)30-25(32)18-11-19(26)21(28)22(29)20(18)27/h2-3,5-7,9-11H,4,8H2,1H3,(H,30,32) |
| InChIKey | KYXIHVUXMWPZIU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|