C22H22N2O2 — CID 46101113
N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]pentanamide (PubChem CID 46101113) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]pentanamide.
| Compound Name | N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 46101113 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(-c2onc3c2CCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C22H22N2O2/c1-2-3-8-20(25)23-17-12-9-16(10-13-17)22-19-14-11-15-6-4-5-7-18(15)21(19)24-26-22/h4-7,9-10,12-13H,2-3,8,11,14H2,1H3,(H,23,25) |
| InChIKey | RNRXITIONGWZGA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |