C17H19ClN2O2 — CID 46101172
2-chloro-N-[2-methyl-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)phenyl]propanamide (PubChem CID 46101172) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 2-chloro-N-[2-methyl-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)phenyl]propanamide.
| Compound Name | 2-chloro-N-[2-methyl-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 46101172 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-chloro-N-[2-methyl-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)phenyl]propanamide |
| SMILES | Cc1ccc(-c2onc3c2CCCC3)cc1NC(=O)C(C)Cl |
| InChI | InChI=1S/C17H19ClN2O2/c1-10-7-8-12(9-15(10)19-17(21)11(2)18)16-13-5-3-4-6-14(13)20-22-16/h7-9,11H,3-6H2,1-2H3,(H,19,21) |
| InChIKey | SRPAKAQPBGVGIN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|