C28H21F3N2O3 — CID 46101207
(E)-N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]-N-methyl-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 46101207) has the molecular formula C28H21F3N2O3 and a molecular weight of 490.48 g/mol. Its IUPAC name is (E)-N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]-N-methyl-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]-N-methyl-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46101207 |
| Molecular Formula | C28H21F3N2O3 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (E)-N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]-N-methyl-3-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1ccc(OC(F)(F)F)cc1)c1ccc(-c2onc3c2CCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C28H21F3N2O3/c1-33(25(34)17-8-18-6-14-22(15-7-18)35-28(29,30)31)21-12-9-20(10-13-21)27-24-16-11-19-4-2-3-5-23(19)26(24)32-36-27/h2-10,12-15,17H,11,16H2,1H3/b17-8+ |
| InChIKey | YSVXBMRFILWARA-CAOOACKPSA-N |
| XLogP | 6.68 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|