C19H19F3N2O4 — CID 46101255
ethyl 3-oxo-3-[3-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)-5-(trifluoromethyl)anilino]propanoate (PubChem CID 46101255) has the molecular formula C19H19F3N2O4 and a molecular weight of 396.37 g/mol. Its IUPAC name is ethyl 3-oxo-3-[3-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)-5-(trifluoromethyl)anilino]propanoate.
| Compound Name | ethyl 3-oxo-3-[3-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)-5-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 46101255 |
| Molecular Formula | C19H19F3N2O4 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | ethyl 3-oxo-3-[3-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)-5-(trifluoromethyl)anilino]propanoate |
| SMILES | CCOC(=O)CC(=O)Nc1cc(-c2onc3c2CCCC3)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3N2O4/c1-2-27-17(26)10-16(25)23-13-8-11(7-12(9-13)19(20,21)22)18-14-5-3-4-6-15(14)24-28-18/h7-9H,2-6,10H2,1H3,(H,23,25) |
| InChIKey | CTVPVGILTXNPFI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|