C23H24F4N2O4S — CID 46101656
ethyl 1-(3-ethoxypropyl)-2-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methylsulfanyl]benzimidazole-5-carboxylate (PubChem CID 46101656) has the molecular formula C23H24F4N2O4S and a molecular weight of 500.51 g/mol. Its IUPAC name is ethyl 1-(3-ethoxypropyl)-2-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methylsulfanyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-(3-ethoxypropyl)-2-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methylsulfanyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 46101656 |
| Molecular Formula | C23H24F4N2O4S |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | ethyl 1-(3-ethoxypropyl)-2-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methylsulfanyl]benzimidazole-5-carboxylate |
| SMILES | CCOCCCn1c(SCc2c(F)c(F)c(OC)c(F)c2F)nc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C23H24F4N2O4S/c1-4-32-10-6-9-29-16-8-7-13(22(30)33-5-2)11-15(16)28-23(29)34-12-14-17(24)19(26)21(31-3)20(27)18(14)25/h7-8,11H,4-6,9-10,12H2,1-3H3 |
| InChIKey | UWLIFFJHIKCWSU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|