About [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate
[1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate (PubChem CID 46102020) has the molecular formula C27H24BrN3O2
and a molecular weight of 502.41 g/mol. Its IUPAC name is [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate.
Molecular Properties
| Compound Name | [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate |
| PubChem CID | 46102020 |
| Molecular Formula | C27H24BrN3O2 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2ccccc2Br)c1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H24BrN3O2/c1-3-30(4-2)27(32)33-25-14-13-24-22(26(25)20-11-9-19(17-29)10-12-20)15-16-31(24)18-21-7-5-6-8-23(21)28/h5-16H,3-4,18H2,1-2H3 |
| InChIKey | YSOMBPPYJMSFJP-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 58.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate?
The IUPAC name of [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate (CID 46102020) is [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate.
What is the SMILES notation for [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate?
The canonical SMILES for [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate is CCN(CC)C(=O)Oc1ccc2c(ccn2Cc2ccccc2Br)c1-c1ccc(C#N)cc1.
What is the InChIKey of [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate?
The InChIKey is YSOMBPPYJMSFJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24BrN3O2/c1-3-30(4-2)27(32)33-25-14-13-24-22(26(25)20-11-9-19(17-29)10-12-20)15-16-31(24)18-21-7-5-6-8-23(21)28/h5-16H,3-4,18H2,1-2H3.
What are the key properties of [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate?
[1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate has a molecular weight of 502.41 g/mol, XLogP of 6.83, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-bromophenyl)methyl]-4-(4-cyanophenyl)indol-5-yl] N,N-diethylcarbamate is sourced from PubChem (CID 46102020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).