C23H19ClF3NO3 — CID 4610221
10-[2-chloro-5-(trifluoromethyl)phenyl]-7-methyl-1,2,3,4,9,11-hexahydroisochromeno[4,3-g][1,3]benzoxazin-5-one (PubChem CID 4610221) has the molecular formula C23H19ClF3NO3 and a molecular weight of 449.86 g/mol. Its IUPAC name is 10-[2-chloro-5-(trifluoromethyl)phenyl]-7-methyl-1,2,3,4,9,11-hexahydroisochromeno[4,3-g][1,3]benzoxazin-5-one.
| Compound Name | 10-[2-chloro-5-(trifluoromethyl)phenyl]-7-methyl-1,2,3,4,9,11-hexahydroisochromeno[4,3-g][1,3]benzoxazin-5-one |
|---|---|
| PubChem CID | 4610221 |
| Molecular Formula | C23H19ClF3NO3 |
| Molecular Weight | 449.86 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 10-[2-chloro-5-(trifluoromethyl)phenyl]-7-methyl-1,2,3,4,9,11-hexahydroisochromeno[4,3-g][1,3]benzoxazin-5-one |
| SMILES | Cc1c2c(cc3c4c(c(=O)oc13)CCCC4)CN(c1cc(C(F)(F)F)ccc1Cl)CO2 |
| InChI | InChI=1S/C23H19ClF3NO3/c1-12-20-13(8-17-15-4-2-3-5-16(15)22(29)31-21(12)17)10-28(11-30-20)19-9-14(23(25,26)27)6-7-18(19)24/h6-9H,2-5,10-11H2,1H3 |
| InChIKey | URPGXYPUNZMGNG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.86 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|