C28H23F3N2O4 — CID 46102210
ethyl 1-benzyl-4-(4-methoxyphenyl)-3-[(2,3,4-trifluorobenzoyl)amino]pyrrole-2-carboxylate (PubChem CID 46102210) has the molecular formula C28H23F3N2O4 and a molecular weight of 508.50 g/mol. Its IUPAC name is ethyl 1-benzyl-4-(4-methoxyphenyl)-3-[(2,3,4-trifluorobenzoyl)amino]pyrrole-2-carboxylate.
| Compound Name | ethyl 1-benzyl-4-(4-methoxyphenyl)-3-[(2,3,4-trifluorobenzoyl)amino]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46102210 |
| Molecular Formula | C28H23F3N2O4 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | ethyl 1-benzyl-4-(4-methoxyphenyl)-3-[(2,3,4-trifluorobenzoyl)amino]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(F)c(F)c2F)c(-c2ccc(OC)cc2)cn1Cc1ccccc1 |
| InChI | InChI=1S/C28H23F3N2O4/c1-3-37-28(35)26-25(32-27(34)20-13-14-22(29)24(31)23(20)30)21(18-9-11-19(36-2)12-10-18)16-33(26)15-17-7-5-4-6-8-17/h4-14,16H,3,15H2,1-2H3,(H,32,34) |
| InChIKey | DJNKXQUCUFAEKB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|