C24H22F4N2O4 — CID 46102242
ethyl 1-benzyl-4-(4-methoxyphenyl)-3-(2,2,3,3-tetrafluoropropanoylamino)pyrrole-2-carboxylate (PubChem CID 46102242) has the molecular formula C24H22F4N2O4 and a molecular weight of 478.44 g/mol. Its IUPAC name is ethyl 1-benzyl-4-(4-methoxyphenyl)-3-(2,2,3,3-tetrafluoropropanoylamino)pyrrole-2-carboxylate.
| Compound Name | ethyl 1-benzyl-4-(4-methoxyphenyl)-3-(2,2,3,3-tetrafluoropropanoylamino)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46102242 |
| Molecular Formula | C24H22F4N2O4 |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | ethyl 1-benzyl-4-(4-methoxyphenyl)-3-(2,2,3,3-tetrafluoropropanoylamino)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(F)(F)C(F)F)c(-c2ccc(OC)cc2)cn1Cc1ccccc1 |
| InChI | InChI=1S/C24H22F4N2O4/c1-3-34-21(31)20-19(29-23(32)24(27,28)22(25)26)18(16-9-11-17(33-2)12-10-16)14-30(20)13-15-7-5-4-6-8-15/h4-12,14,22H,3,13H2,1-2H3,(H,29,32) |
| InChIKey | UREUFXPGQAJOMI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|