C25H22N2O4S — CID 46102298
(5E)-5-[[3-(2-hydroxyethoxy)phenyl]methylidene]-1-methyl-3-(4-phenoxyphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 46102298) has the molecular formula C25H22N2O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is (5E)-5-[[3-(2-hydroxyethoxy)phenyl]methylidene]-1-methyl-3-(4-phenoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-(2-hydroxyethoxy)phenyl]methylidene]-1-methyl-3-(4-phenoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 46102298 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (5E)-5-[[3-(2-hydroxyethoxy)phenyl]methylidene]-1-methyl-3-(4-phenoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=S)N(c2ccc(Oc3ccccc3)cc2)C(=O)/C1=C\c1cccc(OCCO)c1 |
| InChI | InChI=1S/C25H22N2O4S/c1-26-23(17-18-6-5-9-22(16-18)30-15-14-28)24(29)27(25(26)32)19-10-12-21(13-11-19)31-20-7-3-2-4-8-20/h2-13,16-17,28H,14-15H2,1H3/b23-17+ |
| InChIKey | PXJXLSREGFMFJK-HAVVHWLPSA-N |
| XLogP | 4.45 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|