C18H20 — CID 4610239
6,15-dimethyltricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene (PubChem CID 4610239) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 6,15-dimethyltricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene.
| Compound Name | 6,15-dimethyltricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene |
|---|---|
| PubChem CID | 4610239 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 6,15-dimethyltricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene |
| SMILES | Cc1ccc2c(c1)CCc1cc(C)ccc1CC2 |
| InChI | InChI=1S/C18H20/c1-13-3-5-15-7-8-16-6-4-14(2)12-18(16)10-9-17(15)11-13/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | KABDJPCQYZLATR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |